Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Silver foil, 1.0mm (0.04in) thick, annealed, 99.9% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |
Silver wire, 0.64mm (0.025in) dia, annealed, 99.9% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |
Silver powder, spherical, APS 0.6-2 micron, 99.9% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |
Silver rod, 6.35mm (0.25in) dia, 99.9% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |
| CAS | 6-6-7440 |
|---|---|
| MDL Number | MFCD03458043 |
Tungsten wire, 0.05mm (0.002in) dia, annealed, 99.95% (metals basis)
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
Silicon powder, crystalline, APS ∣<50nm, 98%, Laser synthesized from vapor phase
CAS: 7440-21-3 Molecular Formula: Si Molecular Weight (g/mol): 28.09 MDL Number: MFCD00085311 InChI Key: XUIMIQQOPSSXEZ-UHFFFAOYSA-N Synonym: metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 PubChem CID: 5461123 ChEBI: CHEBI:27573 IUPAC Name: silicon SMILES: [Si]
| PubChem CID | 5461123 |
|---|---|
| CAS | 7440-21-3 |
| Molecular Weight (g/mol) | 28.09 |
| ChEBI | CHEBI:27573 |
| MDL Number | MFCD00085311 |
| SMILES | [Si] |
| Synonym | metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 |
| IUPAC Name | silicon |
| InChI Key | XUIMIQQOPSSXEZ-UHFFFAOYSA-N |
| Molecular Formula | Si |
Selenium sulfide, 94%
CAS: 7488-56-4 Molecular Formula: S2Se Molecular Weight (g/mol): 143.09 MDL Number: MFCD00011227 InChI Key: JNMWHTHYDQTDQZ-UHFFFAOYSA-N Synonym: selenium disulfide,selenium disulphide,selsun blue,selenium iv disulfide,selenium sulfide ses2,sebusan,selenex,selenix,selukos,lenium PubChem CID: 24087 IUPAC Name: thione SMILES: S=[Se]=S
| PubChem CID | 24087 |
|---|---|
| CAS | 7488-56-4 |
| Molecular Weight (g/mol) | 143.09 |
| MDL Number | MFCD00011227 |
| SMILES | S=[Se]=S |
| Synonym | selenium disulfide,selenium disulphide,selsun blue,selenium iv disulfide,selenium sulfide ses2,sebusan,selenex,selenix,selukos,lenium |
| IUPAC Name | thione |
| InChI Key | JNMWHTHYDQTDQZ-UHFFFAOYSA-N |
| Molecular Formula | S2Se |
Ytterbium(III) oxide, 99.9% (REO)
CAS: 1314-37-0 Molecular Formula: O3Yb2 Molecular Weight (g/mol): 394.09 MDL Number: MFCD00011290 InChI Key: UZLYXNNZYFBAQO-UHFFFAOYSA-N IUPAC Name: diytterbium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Yb+3].[Yb+3]
| CAS | 1314-37-0 |
|---|---|
| Molecular Weight (g/mol) | 394.09 |
| MDL Number | MFCD00011290 |
| SMILES | [O--].[O--].[O--].[Yb+3].[Yb+3] |
| IUPAC Name | diytterbium(3+) trioxidandiide |
| InChI Key | UZLYXNNZYFBAQO-UHFFFAOYSA-N |
| Molecular Formula | O3Yb2 |
Cerium(III) carbonate hydrate, REacton™, 99.9% (REO)
CAS: 54451-25-1 Molecular Formula: C3Ce2O9 Molecular Weight (g/mol): 460.26 MDL Number: MFCD00149635 InChI Key: GHLITDDQOMIBFS-UHFFFAOYSA-H Synonym: cerium iii carbonate hydrate,acmc-20alhm,cerous carbonate hydrate,ksc267s0r,ce2 co3 3.xh2o,cerium iii carbonate hydrate, reacton,cerium 3+ carbonate-water 2/3/1,dicerium 3+ hydrate tricarbonate,cerium iii carbonate hydrate, reacton reo PubChem CID: 16212049 SMILES: [Ce+3].[Ce+3].[O-]C([O-])=O.[O-]C([O-])=O.[O-]C([O-])=O
| PubChem CID | 16212049 |
|---|---|
| CAS | 54451-25-1 |
| Molecular Weight (g/mol) | 460.26 |
| MDL Number | MFCD00149635 |
| SMILES | [Ce+3].[Ce+3].[O-]C([O-])=O.[O-]C([O-])=O.[O-]C([O-])=O |
| Synonym | cerium iii carbonate hydrate,acmc-20alhm,cerous carbonate hydrate,ksc267s0r,ce2 co3 3.xh2o,cerium iii carbonate hydrate, reacton,cerium 3+ carbonate-water 2/3/1,dicerium 3+ hydrate tricarbonate,cerium iii carbonate hydrate, reacton reo |
| InChI Key | GHLITDDQOMIBFS-UHFFFAOYSA-H |
| Molecular Formula | C3Ce2O9 |
Nickel foil, 0.5mm (0.02in) thick, annealed, 99.5% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Titanium wire, 1.0mm (0.04in) dia, annealed, 99.99% (metals basis)
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
Vinyltrimethylsilane, 98+%
CAS: 754-05-2 Molecular Formula: C5H12Si Molecular Weight (g/mol): 100.236 MDL Number: MFCD00008606 InChI Key: GCSJLQSCSDMKTP-UHFFFAOYSA-N Synonym: vinyltrimethylsilane,trimethyl vinyl silane,trimethylvinylsilane,silane, ethenyltrimethyl,trimethylsilyl ethylene,vinyl trimethylsilane,silane, trimethylvinyl,vinyltrimethysilane,trimethylsilyl ethene,ethenyl-trimethylsilane PubChem CID: 79102 IUPAC Name: ethenyl(trimethyl)silane SMILES: C[Si](C)(C)C=C
| PubChem CID | 79102 |
|---|---|
| CAS | 754-05-2 |
| Molecular Weight (g/mol) | 100.236 |
| MDL Number | MFCD00008606 |
| SMILES | C[Si](C)(C)C=C |
| Synonym | vinyltrimethylsilane,trimethyl vinyl silane,trimethylvinylsilane,silane, ethenyltrimethyl,trimethylsilyl ethylene,vinyl trimethylsilane,silane, trimethylvinyl,vinyltrimethysilane,trimethylsilyl ethene,ethenyl-trimethylsilane |
| IUPAC Name | ethenyl(trimethyl)silane |
| InChI Key | GCSJLQSCSDMKTP-UHFFFAOYSA-N |
| Molecular Formula | C5H12Si |
1,3,5-Trimethyl-1,3,5-tris(3,3,3-trifluoropropyl)cyclotrisiloxane, 97%
CAS: 2374-14-3 Molecular Formula: C12H21F9O3Si3 Molecular Weight (g/mol): 468.538 MDL Number: MFCD00054667 InChI Key: URZHQOCYXDNFGN-UHFFFAOYSA-N Synonym: silicone fluid,fluorosilicone trimer,1,3,5-trimethyl-1,3,5-tris 3,3,3-trifluoropropyl cyclotrisiloxane,1,3,5-tris 3,3,3-trifluoropropyl methyl cyclotrisiloxane,cyclotrisiloxane, 2,4,6-trimethyl-2,4,6-tris 3,3,3-trifluoropropyl,fluorosilicone cyclic trimer,b071 cut ii,3,3,3-trifluoropropyl methylcyclotrisiloxane,2,4,6-trimethyl-2,4,6-tris 3,3,3-trifluoropropyl cyclotrisiloxane,3,3,3-trifluoropropyl methylsiloxane cyclic trimer PubChem CID: 75410 IUPAC Name: 2,4,6-trimethyl-2,4,6-tris(3,3,3-trifluoropropyl)-1,3,5,2,4,6-trioxatrisilinane SMILES: C[Si]1(O[Si](O[Si](O1)(C)CCC(F)(F)F)(C)CCC(F)(F)F)CCC(F)(F)F
| PubChem CID | 75410 |
|---|---|
| CAS | 2374-14-3 |
| Molecular Weight (g/mol) | 468.538 |
| MDL Number | MFCD00054667 |
| SMILES | C[Si]1(O[Si](O[Si](O1)(C)CCC(F)(F)F)(C)CCC(F)(F)F)CCC(F)(F)F |
| Synonym | silicone fluid,fluorosilicone trimer,1,3,5-trimethyl-1,3,5-tris 3,3,3-trifluoropropyl cyclotrisiloxane,1,3,5-tris 3,3,3-trifluoropropyl methyl cyclotrisiloxane,cyclotrisiloxane, 2,4,6-trimethyl-2,4,6-tris 3,3,3-trifluoropropyl,fluorosilicone cyclic trimer,b071 cut ii,3,3,3-trifluoropropyl methylcyclotrisiloxane,2,4,6-trimethyl-2,4,6-tris 3,3,3-trifluoropropyl cyclotrisiloxane,3,3,3-trifluoropropyl methylsiloxane cyclic trimer |
| IUPAC Name | 2,4,6-trimethyl-2,4,6-tris(3,3,3-trifluoropropyl)-1,3,5,2,4,6-trioxatrisilinane |
| InChI Key | URZHQOCYXDNFGN-UHFFFAOYSA-N |
| Molecular Formula | C12H21F9O3Si3 |
3-(Phenylamino)propyltrimethoxysilane, 96%
CAS: 3068-76-6 Molecular Formula: C12H21NO3Si Molecular Weight (g/mol): 255.389 MDL Number: MFCD00053673 InChI Key: KBJFYLLAMSZSOG-UHFFFAOYSA-N Synonym: n-3-trimethoxysilyl propyl aniline,trimethoxy 3-phenylamino propyl silane,n-phenylaminopropyltrimethoxysilane,unii-7au1h1fv6a,benzenamine, n-3-trimethoxysilyl propyl,n-phenyl-3-aminopropyltrimethoxysilane,7au1h1fv6a,n-3-trimethoxysilylpropyl aniline,3-phenylamino propyltrimethoxysilane PubChem CID: 76476 IUPAC Name: N-(3-trimethoxysilylpropyl)aniline SMILES: CO[Si](CCCNC1=CC=CC=C1)(OC)OC
| PubChem CID | 76476 |
|---|---|
| CAS | 3068-76-6 |
| Molecular Weight (g/mol) | 255.389 |
| MDL Number | MFCD00053673 |
| SMILES | CO[Si](CCCNC1=CC=CC=C1)(OC)OC |
| Synonym | n-3-trimethoxysilyl propyl aniline,trimethoxy 3-phenylamino propyl silane,n-phenylaminopropyltrimethoxysilane,unii-7au1h1fv6a,benzenamine, n-3-trimethoxysilyl propyl,n-phenyl-3-aminopropyltrimethoxysilane,7au1h1fv6a,n-3-trimethoxysilylpropyl aniline,3-phenylamino propyltrimethoxysilane |
| IUPAC Name | N-(3-trimethoxysilylpropyl)aniline |
| InChI Key | KBJFYLLAMSZSOG-UHFFFAOYSA-N |
| Molecular Formula | C12H21NO3Si |